| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:48 UTC |
|---|
| Update Date | 2025-03-25 00:53:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203052 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O2 |
|---|
| Molecular Mass | 218.1055 |
|---|
| SMILES | O=C(c1cccnc1)N1CC2COC(C2)C1 |
|---|
| InChI Key | QSQYERRQEBUQIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-oxazepinesazacyclic compoundscarboxylic acids and derivativesdialkyl ethersheteroaromatic compoundshydrocarbon derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | pyridine carboxylic acid or derivativesetherazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupcarboxylic acid derivativedialkyl etherpara-oxazepineoxacyclen-acyl-piperidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpiperidineorganooxygen compound |
|---|
