| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:49 UTC |
|---|
| Update Date | 2025-03-25 00:53:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203085 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO4 |
|---|
| Molecular Mass | 227.1158 |
|---|
| SMILES | O=C1CCC(C2CCC(O)(C(=O)O)CC2)N1 |
|---|
| InChI Key | KBPGBHKOXYPAGE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidine-2-onessecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | 2-pyrrolidonecarbonyl grouplactamcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundazacyclecyclohexanolhydroxy acidcyclic alcoholcarboxamide groupsecondary carboxylic acid amidetertiary alcoholmonocarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compound |
|---|
