| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:49 UTC |
|---|
| Update Date | 2025-03-25 00:53:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203087 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9NO5 |
|---|
| Molecular Mass | 187.0481 |
|---|
| SMILES | O=C1CCC(C(O)C(=O)O)C(=O)N1 |
|---|
| InChI Key | CKOVYXNAXIFWQO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinones |
|---|
| Direct Parent | piperidinediones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdelta lactamsdicarboximideshydrocarbon derivativesmonocarboxylic acids and derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinedionedicarboximidealcoholazacyclehydroxy acidcarboxylic acid imidedelta-lactammonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
