| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:50 UTC |
|---|
| Update Date | 2025-03-25 00:53:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203138 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O6 |
|---|
| Molecular Mass | 352.0947 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)OC2=C1C(=O)CC(c1ccc(O)cc1)O2 |
|---|
| InChI Key | RPZUFRPJUXUZKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesdihydropyranoneshydrocarbon derivativesketonesorganic oxidesoxacyclic compoundsvinylogous esters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupdihydropyranonevinylogous ester1-hydroxy-2-unsubstituted benzenoidketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonephenollinear 1,7-diphenylheptane skeletonhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
