| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:53 UTC |
|---|
| Update Date | 2025-03-25 00:53:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203267 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O7 |
|---|
| Molecular Mass | 202.0114 |
|---|
| SMILES | O=C(O)CC1OC(=O)C(O)=C(O)C1=O |
|---|
| InChI Key | OYXUTAWMXHZPRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha-acyloxy ketonescarboxylic acidscyclic ketonesdicarboxylic acids and derivativesenoate estershydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsvinylogous acids |
|---|
| Substituents | enoate estercarbonyl groupcarboxylic acidalpha-acyloxy ketonedihydropyranonecyclic ketonecarboxylic acid derivativeketonelactoneoxacyclealpha,beta-unsaturated carboxylic estervinylogous acidorganic oxideorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
