| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:57 UTC |
|---|
| Update Date | 2025-03-25 00:54:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203424 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20O12 |
|---|
| Molecular Mass | 368.0955 |
|---|
| SMILES | O=C(O)CC(O)(CC(=O)O)CC(=O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | GTWLAMYHBXCFKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estershemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholstertiary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | alcoholfatty acylcarbonyl groupcarboxylic acidmonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativeoxacyclefatty acid estertertiary alcoholsaccharideorganic oxideorganic oxygen compoundcarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxanesaccharolipidorganoheterocyclic compoundorganooxygen compound |
|---|
