| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:00:59 UTC |
|---|
| Update Date | 2025-03-25 00:54:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203480 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6F2O6 |
|---|
| Molecular Mass | 212.0132 |
|---|
| SMILES | O=C(O)CC(C(=O)O)(C(=O)O)C(F)F |
|---|
| InChI Key | NUNIEJVYGXBLCK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridescarbonyl compoundscarboxylic acidsfatty acylshalogenated fatty acidshydrocarbon derivativesorganic oxidesorganofluorides |
|---|
| Substituents | halogenated fatty acidfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidalkyl fluorideorganofluoridetricarboxylic acid or derivativesorganohalogen compoundorganic oxideorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
