| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:04 UTC |
|---|
| Update Date | 2025-03-25 00:54:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203698 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO4 |
|---|
| Molecular Mass | 273.1001 |
|---|
| SMILES | O=C(O)CCC(Nc1ccc2ccccc2c1)C(=O)O |
|---|
| InChI Key | OHJHURALJDDQEA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesnaphthalenesorganic oxidesorganopnictogen compoundssecondary alkylarylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acidaromatic homopolycyclic compoundglutamic acid or derivativessecondary aminesecondary aliphatic/aromatic amineorganic oxidenaphthaleneorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
