| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:05 UTC |
|---|
| Update Date | 2025-03-25 00:54:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203710 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O6 |
|---|
| Molecular Mass | 290.079 |
|---|
| SMILES | O=C(O)CCC1=C(CC(=O)O)Cc2cc3c(cc21)OCO3 |
|---|
| InChI Key | RWWDEPBLQKTUGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxoles |
|---|
| Subclass | benzodioxoles |
|---|
| Direct Parent | benzodioxoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesindenes and isoindenesorganic oxidesoxacyclic compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxideindeneorganic oxygen compoundacetalaromatic heteropolycyclic compounddicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganooxygen compoundbenzodioxole |
|---|