| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:08 UTC |
|---|
| Update Date | 2025-03-25 00:54:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203827 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O5 |
|---|
| Molecular Mass | 340.1311 |
|---|
| SMILES | OC1CC(Oc2ccc3c(ccc4ccccc43)c2)C(O)C(O)C1O |
|---|
| InChI Key | AZTZQQAFJAVLGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscyclitols and derivativescyclohexanolshydrocarbon derivativesnaphthalenesphenol ethers |
|---|
| Substituents | alcoholphenol etherphenanthreneethercyclohexanolcyclitol or derivativesaromatic homopolycyclic compoundcyclic alcoholalkyl aryl ethernaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
