| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:10 UTC |
|---|
| Update Date | 2025-03-25 00:54:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203911 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O6 |
|---|
| Molecular Mass | 304.0947 |
|---|
| SMILES | OCC1(O)Cc2ccc(O)cc2OC1c1ccc(O)c(O)c1 |
|---|
| InChI Key | CSHTUJZEUVCEKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesoxacyclic compoundstertiary alcohols |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundchromaneorganoheterocyclic compound1,2-diolalcoholbenzopyran1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycletertiary alcoholorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|