| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:11 UTC |
|---|
| Update Date | 2025-03-25 00:54:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203951 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O6 |
|---|
| Molecular Mass | 228.0634 |
|---|
| SMILES | O=c1ccocc1C1OC(CO)C(O)C1O |
|---|
| InChI Key | MQHDOZYHYBDKHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | cyclic ketonesdialkyl ethersheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholetheraromatic heteromonocyclic compoundtetrahydrofuranheteroaromatic compoundmonosaccharidecyclic ketonedialkyl etheroxacyclesaccharideorganic oxideorganic oxygen compoundpyranonesecondary alcoholhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|