| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:11 UTC |
|---|
| Update Date | 2025-03-25 00:54:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203960 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O13PS |
|---|
| Molecular Mass | 434.0032 |
|---|
| SMILES | O=c1ccn(C2OC(COP(=O)(O)O)C(O)C(OS(=O)(=O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | LZOKUQNJVJFWOL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyrimidonessecondary alcoholssulfuric acid monoestersvinylogous amides |
|---|
| Substituents | sulfuric acid monoesterlactamaromatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeorganic sulfuric acid or derivativesazacycleheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatesulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganic phosphoric acid derivativealkyl phosphate |
|---|
