| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:12 UTC |
|---|
| Update Date | 2025-03-25 00:54:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02203976 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11N3O2 |
|---|
| Molecular Mass | 217.0851 |
|---|
| SMILES | O=c1nc(NCc2ccccc2O)cc[nH]1 |
|---|
| InChI Key | WMZRHOWMSNNIIF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary alkylarylamines |
|---|
| Substituents | monocyclic benzene moietycarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidpyrimidone1-hydroxy-4-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic amineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundimidolactamorganooxygen compoundamine |
|---|
