| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:14 UTC |
|---|
| Update Date | 2025-03-25 00:54:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204066 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O7S |
|---|
| Molecular Mass | 221.9834 |
|---|
| SMILES | O=c1oc(CO)ccc1OS(=O)(=O)O |
|---|
| InChI Key | PSTMBKGJGUJMLW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholsulfuric acid monoesteraromatic heteromonocyclic compoundheteroaromatic compoundlactoneoxacycleorganic oxideorganic oxygen compoundpyranpyranonesulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
