| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:15 UTC |
|---|
| Update Date | 2025-03-25 00:54:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204123 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O4S |
|---|
| Molecular Mass | 352.0769 |
|---|
| SMILES | Oc1ccc(C2Oc3cc(O)ccc3SC2c2ccc(O)cc2)cc1 |
|---|
| InChI Key | WJYQHSMHOOGOPZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalkylarylthioethersbenzene and substituted derivativesbenzoxathiinshydrocarbon derivativesoxacyclic compoundsoxathiins |
|---|
| Substituents | monocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheralkylarylthioetheraryl thioetheroxacycleorganic oxygen compound1,4-benzooxathiinaromatic heteropolycyclic compoundthioetherphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound1,4-oxathiinstilbene |
|---|