| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:16 UTC |
|---|
| Update Date | 2025-03-25 00:54:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204127 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24O5 |
|---|
| Molecular Mass | 332.1624 |
|---|
| SMILES | Oc1ccc(CCC(O)CC(O)CCc2cc(O)cc(O)c2)cc1 |
|---|
| InChI Key | VAHJEIXNAHVPGS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesfatty alcoholshydrocarbon derivativesresorcinolssecondary alcohols |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moiety1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidresorcinolaromatic homomonocyclic compoundorganic oxygen compoundfatty alcoholsecondary alcohollinear 1,7-diphenylheptane skeletonphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|