| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:17 UTC |
|---|
| Update Date | 2025-03-25 00:54:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204173 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H17O8+ |
|---|
| Molecular Mass | 385.0918 |
|---|
| SMILES | Oc1ccc(-c2[o+]c3c(c(O)c2O)CC(O)C(c2ccc(O)c(O)c2)O3)cc1 |
|---|
| InChI Key | HNYBWRVXUUHVCJ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholphenollinear 1,7-diphenylheptane skeletonhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
