| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:17 UTC |
|---|
| Update Date | 2025-03-25 00:54:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204190 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13NO3 |
|---|
| Molecular Mass | 243.0895 |
|---|
| SMILES | Oc1ccc(C2(O)CNc3cc(O)ccc32)cc1 |
|---|
| InChI Key | OYORMEYPSVVQFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesindolinesorganopnictogen compoundssecondary alkylarylaminestertiary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyazacycleindole1-hydroxy-2-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic aminetertiary alcoholorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compounddihydroindoleamineorganooxygen compound |
|---|
