| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:21 UTC |
|---|
| Update Date | 2025-03-25 00:54:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204353 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24O8 |
|---|
| Molecular Mass | 404.1471 |
|---|
| SMILES | OCC1OC(OC2CC(c3ccc(O)cc3)c3ccccc3O2)C(O)C(O)C1O |
|---|
| InChI Key | YOIUMCLIALRHLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | neoflavonoids |
|---|
| Subclass | neoflavans |
|---|
| Direct Parent | neoflavans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativeshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | neoflavanalcoholmonocyclic benzene moietybenzopyran1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharideoxacyclesaccharideorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholchromanephenolhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|