| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:22 UTC |
|---|
| Update Date | 2025-03-25 00:54:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204394 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O8 |
|---|
| Molecular Mass | 330.1315 |
|---|
| SMILES | OCCc1ccc(OC2OC(C(O)CO)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | ZSWDKCCUYBRDKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharideoxacyclesaccharideorganic oxygen compoundacetalsecondary alcoholhydrocarbon derivativetyrosol derivativephenoxy compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|