| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:23 UTC |
|---|
| Update Date | 2025-03-25 00:54:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204416 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10O5 |
|---|
| Molecular Mass | 210.0528 |
|---|
| SMILES | Oc1cc(C2OCC3OC32)cc(O)c1O |
|---|
| InChI Key | YHQQZLCREVUMMN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-dioxanes1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethersepoxideshydrocarbon derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietyetherpyrogallol derivativetetrahydrofuranoxirane1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundpara-dioxanehydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
