| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:24 UTC |
|---|
| Update Date | 2025-03-25 00:54:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204475 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H5O8P |
|---|
| Molecular Mass | 211.9722 |
|---|
| SMILES | O=CC(OP(=O)(O)O)=C(O)C(=O)O |
|---|
| InChI Key | OHLIXQKURHFXOY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | hydroxy fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aldehydescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphosphate estersshort-chain hydroxy acids and derivativesunsaturated fatty acidsvinylogous acids |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidaldehydecarboxylic acid derivativeunsaturated fatty acidvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativehydroxy fatty acidorganic phosphoric acid derivativeorganooxygen compound |
|---|
