| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:25 UTC |
|---|
| Update Date | 2025-03-25 00:54:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204513 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O12 |
|---|
| Molecular Mass | 342.0798 |
|---|
| SMILES | O=CC(O)C(O)C(OC1OC(O)C(O)C(C(=O)O)O1)C(O)CO |
|---|
| InChI Key | LKQBLWFDWOUNIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanesalpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acid orthoesterscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesortho estersoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl groupcarboxylic acidortho estermonosaccharidecarboxylic acid orthoestercarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydefatty alcoholaliphatic heteromonocyclic compoundhemiacetalorthocarboxylic acid derivativeprimary alcoholorganoheterocyclic compoundalcoholaldehydehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativemeta-dioxaneorganooxygen compound |
|---|
