| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:26 UTC |
|---|
| Update Date | 2025-03-25 00:54:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204546 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H19O14P3 |
|---|
| Molecular Mass | 431.9988 |
|---|
| SMILES | O=P(O)(O)CC1C(O)C(O)C(O)C(O)C1COP(=O)(O)OP(=O)(O)O |
|---|
| InChI Key | RGLMEVOCXQOCGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organic oxoanionic compounds |
|---|
| Subclass | organic pyrophosphates |
|---|
| Direct Parent | organic pyrophosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativescyclohexanolshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | alcoholcyclohexanolcyclitol or derivativescyclic alcoholorganic pyrophosphateorganic oxidephosphoric acid estermonoalkyl phosphatesecondary alcoholaliphatic homomonocyclic compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganophosphonic acid derivativealkyl phosphateorganooxygen compound |
|---|
