| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:26 UTC |
|---|
| Update Date | 2025-03-25 00:54:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204547 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H15O13P3 |
|---|
| Molecular Mass | 387.9726 |
|---|
| SMILES | O=P(O)(O)CC1C(OP(=O)(O)O)OC(COP(=O)(O)O)C1O |
|---|
| InChI Key | WTNKDCODUUGKHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholtetrahydrofuranpentose phosphatepentose-5-phosphateoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganophosphonic acid derivativealkyl phosphateorganoheterocyclic compound |
|---|
