| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:27 UTC |
|---|
| Update Date | 2025-03-25 00:54:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204557 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15NO10 |
|---|
| Molecular Mass | 297.0696 |
|---|
| SMILES | O=NOC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | NNCLXBNQANWBDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | c-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl nitritesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesnitrite estersorganic o-nitroso compoundsorganic nitrogen compoundsorganic oxidesoxacyclic compoundsoxanesprimary alcoholspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativepyran carboxylic acidalkyl nitriteorganic oxidealiphatic heteromonocyclic compoundhemiacetalnitrite esteroxaneprimary alcoholorganoheterocyclic compoundc-glucuronidealcoholorganic nitroso compoundpyran carboxylic acid or derivativeshydroxy acidorganic nitriteoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic o-nitroso compound |
|---|
