| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:28 UTC |
|---|
| Update Date | 2025-03-25 00:54:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204632 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28O13S |
|---|
| Molecular Mass | 556.1251 |
|---|
| SMILES | O=C1OCC(Cc2cccc(O)c2)C1Cc1ccc(OC2OC(COS(=O)(=O)O)C(O)C(O)C2O)c(O)c1 |
|---|
| InChI Key | NEJZZMNPHPUYJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan glycosides |
|---|
| Subclass | lignan glycosides |
|---|
| Direct Parent | lignan glycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl glycosidesalkyl sulfatescarbonyl compoundscarboxylic acid estersdibenzylbutyrolactone lignansfatty acyl glycosides of mono- and disaccharidesgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidephenol ethermonocyclic benzene moietysulfuric acid monoestercarbonyl grouparomatic heteromonocyclic compoundlignan glycosidedibenzylbutyrolactone1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativelignan lactonelactonesaccharideorganic oxideacetalalkyl sulfate9,9p-epoxylignanoxaneorganoheterocyclic compoundalcoholorganic sulfuric acid or derivativestetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignansecondary alcoholsulfate-esterphenolhydrocarbon derivativetetrahydrofuran lignanbenzenoidphenoxy compoundsulfuric acid esterorganooxygen compoundalkyl glycoside |
|---|