| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:30 UTC |
|---|
| Update Date | 2025-03-25 00:54:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204685 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O8 |
|---|
| Molecular Mass | 222.0376 |
|---|
| SMILES | O=C1OC(C(=O)O)C(O)(CO)C(O)C1O |
|---|
| InChI Key | HWNNZDRRXPTFPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsdelta valerolactonesdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic aciddelta valerolactonecarboxylic acid derivativepyran carboxylic acidlactoneorganic oxidegluconolactonealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesoxacycletertiary alcoholpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivative |
|---|
