| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:31 UTC |
|---|
| Update Date | 2025-03-25 00:54:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204736 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20O11 |
|---|
| Molecular Mass | 340.1006 |
|---|
| SMILES | O=CC(O)C(O)C(OC1C(O)C(=O)OC(CO)C1O)C(O)CO |
|---|
| InChI Key | YNXFYIMVPYWDSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acid estersdelta valerolactonesdialkyl ethersfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy aldehydecarbonyl groupetherdelta valerolactonecarboxylic acid derivativedialkyl etherlactoneorganic oxidealpha-hydroxyaldehydegluconolactonefatty alcoholaliphatic heteromonocyclic compoundoxaneprimary alcoholdelta_valerolactoneorganoheterocyclic compoundalcoholaldehydeoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivative |
|---|
