| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:32 UTC |
|---|
| Update Date | 2025-03-25 00:54:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204749 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17NO6 |
|---|
| Molecular Mass | 295.1056 |
|---|
| SMILES | O=C=C(NC1C(O)OC(CO)C(O)C1O)c1ccccc1 |
|---|
| InChI Key | XENJTPNLEUBNKZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativesdialkylamineshemiacetalshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholsynolates |
|---|
| Substituents | alcoholsecondary aliphatic aminemonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharidesecondary amineoxacycleorganic oxideynolateorganonitrogen compoundsecondary alcoholorganopnictogen compoundhemiacetalhydrocarbon derivativebenzenoidorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compoundamine |
|---|
