| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:33 UTC |
|---|
| Update Date | 2025-03-25 00:54:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204815 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5O8P |
|---|
| Molecular Mass | 349.0423 |
|---|
| SMILES | O=c1[nH]c(=O)n2ncnc2n1C1CC(O)C(COP(=O)(O)O)O1 |
|---|
| InChI Key | RYNCLRZWAVGHFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshalo-s-triazinesheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofuranstriazinonestriazoles |
|---|
| Substituents | triazolepentose phosphateorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolealcoholcarbonic acid derivative1,2,4-triazoleazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid esterhalo-s-triazinemonoalkyl phosphatesecondary alcoholtriazinehydrocarbon derivative1,3,5-triazineorganic nitrogen compoundorganic phosphoric acid derivativetriazinonealkyl phosphate |
|---|
