| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:33 UTC |
|---|
| Update Date | 2025-03-25 00:54:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204817 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13IN2O11P2 |
|---|
| Molecular Mass | 513.9039 |
|---|
| SMILES | O=c1[nH]c(=O)n(C2CC(O)C(COP(=O)(O)OP(=O)(O)O)O2)cc1I |
|---|
| InChI Key | FAJKQODBFVVUQG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl iodidesazacyclic compoundshalopyrimidinesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundpentose phosphatepyrimidoneorganohalogen compoundpyrimidineorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundhalopyrimidineorganic pyrophosphatearyl halideoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativearyl iodideorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|