| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:34 UTC |
|---|
| Update Date | 2025-03-25 00:54:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204842 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O4S2 |
|---|
| Molecular Mass | 248.0177 |
|---|
| SMILES | O=S(=O)(O)SCC(O)Cc1ccccc1 |
|---|
| InChI Key | COCUUCDSTBAYBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidess-alkyl thiosulfatessecondary alcoholssulfenyl compounds |
|---|
| Substituents | alcoholmonocyclic benzene moietysulfenyl compoundorganosulfur compounds-alkyl thiosulfatearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
