| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:35 UTC |
|---|
| Update Date | 2025-03-25 00:54:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204895 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H22O11 |
|---|
| Molecular Mass | 474.1162 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc(-c2ccc(O)c(O)c2)c1OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | LZKYBNCUVWJSPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativescyclic ketonesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidecyclic ketone1-hydroxy-4-unsubstituted benzenoidoxacyclesaccharideorganic oxideorganic oxygen compoundacetalpyranonesecondary alcoholphenolhydrocarbon derivativebenzenoidoxaneprimary alcoholorganooxygen compound |
|---|
