| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:37 UTC |
|---|
| Update Date | 2025-03-25 00:54:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204961 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8PS |
|---|
| Molecular Mass | 245.9599 |
|---|
| SMILES | O=P1(O)OCC2OS(=O)(=O)OCC2O1 |
|---|
| InChI Key | BINUYOKLQFJGHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid diesters |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesdioxathiolaneshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | dioxathiolanealiphatic heteropolycyclic compoundoxacycleorganic oxideorganic oxygen compoundsulfuric acid diesteralkyl sulfatehydrocarbon derivativeorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
