| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:37 UTC |
|---|
| Update Date | 2025-03-25 00:54:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204970 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H12O10P2 |
|---|
| Molecular Mass | 293.9906 |
|---|
| SMILES | O=P(O)(O)OP1(=O)OCC(O)(CO)C(O)C1O |
|---|
| InChI Key | FXIAHFVLSIQQGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphosphacyclic compoundsphosphonic acid esterssecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholphosphacyclephosphonic acid esteroxacycletertiary alcoholorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic phosphoric acid derivativeorganophosphonic acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
