| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:38 UTC |
|---|
| Update Date | 2025-03-25 00:54:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02204997 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H3F11O7S2 |
|---|
| Molecular Mass | 459.9145 |
|---|
| SMILES | O=S(=O)(O)C(O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | ZGGHLCKXMUNCQU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesfluorohydrinshydrocarbon derivativesorganic oxidesorganofluoridesorganooxygen compoundssulfonyls |
|---|
| Substituents | aliphatic acyclic compoundhalohydrinalkyl fluorideorganofluorideorganosulfonic acidfluorohydrinorganosulfur compoundorganohalogen compoundorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|