| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:39 UTC |
|---|
| Update Date | 2025-03-25 00:54:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205028 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H15O18P5 |
|---|
| Molecular Mass | 505.8946 |
|---|
| SMILES | O=P(O)(O)OCC1O[PH](O)(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | ZGBPFKGFCCLYCA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxaphospholanesphosphacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholphosphacycleoxacycle1,2_oxaphospholaneorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|