| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:44 UTC |
|---|
| Update Date | 2025-03-25 00:54:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205209 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21NO13 |
|---|
| Molecular Mass | 411.1013 |
|---|
| SMILES | NC1C(O)CC(OC2OC(C(=O)O)C(O)C(O)C2O)(C(=O)O)OC1CC(=O)O |
|---|
| InChI Key | HTGMMKLPPALHKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativesc-glucuronidescarbonyl compoundscarboxylic acidsdelta amino acids and derivativesgamma amino acids and derivativesglucuronic acid derivativeshydrocarbon derivativesketalsmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidgamma amino acid or derivativeso-glucuronidemonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalketalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativesoxaneorganoheterocyclic compoundc-glucuronidealcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclepyransecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
|---|