| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:47 UTC |
|---|
| Update Date | 2025-03-25 00:54:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205313 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H23N6O9P |
|---|
| Molecular Mass | 510.1264 |
|---|
| SMILES | NC(Cc1ccc(O)cc1)C(=O)Nc1ncnc2c1ncn2C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | OWMDGUHOZNBRAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | purine ribonucleotides |
|---|
| Direct Parent | purine ribonucleoside monophosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesfatty amidesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonoalkylaminesmonosaccharidesn-arylamidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundspentose phosphatesphenylalanine and derivativespurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amidestetrahydrofuranstyrosine and derivatives |
|---|
| Substituents | monocyclic benzene moietypurine ribonucleoside monophosphatemonosaccharidepentose-5-phosphatealpha-amino acid or derivativesimidazopyrimidinesaccharideorganonitrogen compoundalpha-amino acidorganoheterocyclic compound1,2-diolalcoholtyrosine or derivativesalpha-amino acid amideazacycleheteroaromatic compoundsecondary carboxylic acid amidemonoalkyl phosphatephenolhydrocarbon derivativeprimary aliphatic aminefatty acylcarbonyl grouppentose phosphatefatty amide1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganopnictogen compoundimidolactamamphetamine or derivativesazolen-substituted imidazoletetrahydrofurancarboxamide groupoxacyclephenylalanine or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholbenzenoidpurineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|