| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:48 UTC |
|---|
| Update Date | 2025-03-25 00:54:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205354 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N2O5 |
|---|
| Molecular Mass | 292.1059 |
|---|
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)OCC(O)C(=O)O |
|---|
| InChI Key | XCCOMMYEOCULGB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | depsipeptides |
|---|
| Direct Parent | glycodepsipeptides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acid estersalpha amino acidsalpha hydroxy acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estersheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidindolealpha-hydroxy acidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativesaccharideorganic oxideglyceric_acidaromatic heteropolycyclic compoundglycodepsipeptideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundalcoholalpha-amino acid esterazacycleheteroaromatic compoundindole or derivativeshydroxy acidfatty acid esterorganic oxygen compoundcarboxylic acid esterpyrrolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
