| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:50 UTC |
|---|
| Update Date | 2025-03-25 00:54:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205453 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17NO3S2 |
|---|
| Molecular Mass | 287.065 |
|---|
| SMILES | NC(Cc1ccccc1)C(O)CSSCC(=O)O |
|---|
| InChI Key | DLYDKZPGKXELGK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkyldisulfideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssulfenyl compounds |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidsulfenyl compoundorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compounddialkyldisulfideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganic disulfideorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamphetamine or derivatives |
|---|
