| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:55 UTC |
|---|
| Update Date | 2025-03-25 00:54:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205616 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6INO4S |
|---|
| Molecular Mass | 326.9062 |
|---|
| SMILES | NS(=O)(=O)c1cc(C(=O)O)ccc1I |
|---|
| InChI Key | TUYSMPKJKOPZOE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 4-halobenzoic acidsaminosulfonyl compoundsaryl iodidesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarboxylic acidshalobenzoic acidshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganoiodidesorganooxygen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidbenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganosulfonic acid amideorganic oxidebenzoic acidbenzenesulfonyl grouphalobenzoic acidbenzenesulfonamide4-halobenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativesaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
