| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:55 UTC |
|---|
| Update Date | 2025-03-25 00:54:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205621 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11ClN2O4S |
|---|
| Molecular Mass | 314.0128 |
|---|
| SMILES | NS(=O)(=O)c1cc(C(=O)NCc2ccco2)ccc1Cl |
|---|
| InChI Key | GVSNEYDDDBTXHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4-halobenzoic acids and derivativesaminosulfonyl compoundsaryl chloridesbenzamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativeschlorobenzenesfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesoxacyclic compoundssecondary carboxylic acid amides |
|---|
| Substituents | furanorganosulfonic acid or derivativesaromatic heteromonocyclic compoundorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundbenzamideorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideaminosulfonyl compoundheteroaromatic compoundbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide grouparyl halide4-halobenzoic acid or derivativesoxacyclesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|