| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:55 UTC |
|---|
| Update Date | 2025-03-25 00:54:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205625 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H6NO8PS |
|---|
| Molecular Mass | 234.9552 |
|---|
| SMILES | NS(=O)(=O)OC(=O)COP(=O)(O)O |
|---|
| InChI Key | GUSSIDPVBZUHRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouporganic sulfuric acid or derivativescarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
