| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:55 UTC |
|---|
| Update Date | 2025-03-25 00:54:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205630 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6Cl2N2O4S |
|---|
| Molecular Mass | 283.9425 |
|---|
| SMILES | NS(=O)(=O)NC(=O)Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | SMCNCYIPLCZXNZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | aryl chloridecarbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativesorganochlorideorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
