| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:01:55 UTC |
|---|
| Update Date | 2025-03-25 00:54:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205647 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11NO7S |
|---|
| Molecular Mass | 349.0256 |
|---|
| SMILES | NS(=O)(=O)c1cc2c(=O)c(O)c(-c3ccc(O)cc3)oc2cc1O |
|---|
| InChI Key | XHKOGPVVNSTXOJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsaminosulfonyl compoundsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | 3-hydroxyflavoneorganosulfonic acid or derivativesmonocyclic benzene moiety3-hydroxyflavonoid1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundorganosulfonic acid amideorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranaminosulfonyl compoundheteroaromatic compoundoxacyclesulfonylorganic oxygen compoundorganic sulfonic acid or derivativespyran7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
