| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:03 UTC |
|---|
| Update Date | 2025-03-25 00:54:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02205933 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H27N3O12 |
|---|
| Molecular Mass | 525.1595 |
|---|
| SMILES | NC(CCC(=O)NC(Cc1c[nH]c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc12)C(=O)O)C(=O)O |
|---|
| InChI Key | ORMZAQLFFVYINM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | dipeptides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalpha amino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesglutamine and derivativesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonosaccharidesn-acyl aminesn-acyl-alpha amino acidso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyrrolessecondary alcoholssecondary carboxylic acid amidestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylphenol ethercarbonyl groupcarboxylic acidglucuronic acid or derivativesglutamine or derivativesindolefatty amideo-glucuronidemonosaccharidetricarboxylic acid or derivativesalpha-amino acid or derivativespyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesalcoholpyran carboxylic acid or derivativesazacyclen-acyl-alpha-amino acidheteroaromatic compoundindole or derivativeshydroxy acidcarboxamide groupn-acyl-aminealpha-dipeptideoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyranpyrrolesecondary alcoholhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|