| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:02:05 UTC |
|---|
| Update Date | 2025-03-25 00:54:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02206009 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N4O |
|---|
| Molecular Mass | 230.1168 |
|---|
| SMILES | NC(=O)Cc1ccc(NCc2cnc[nH]2)cc1 |
|---|
| InChI Key | ANDDLNFNPMOREO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary carboxylic acid amidessecondary alkylarylamines |
|---|
| Substituents | primary carboxylic acid amidecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compoundazoleazacycleheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic amineorganic oxygen compoundphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
